C14H17ClN4O4S — CID 118385233
3-(chloromethyl)-5-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-1,2,4-oxadiazole (PubChem CID 118385233) has the molecular formula C14H17ClN4O4S and a molecular weight of 372.83 g/mol. Its IUPAC name is 3-(chloromethyl)-5-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(chloromethyl)-5-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 118385233 |
| Molecular Formula | C14H17ClN4O4S |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 3-(chloromethyl)-5-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-1,2,4-oxadiazole |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3nc(CCl)no3)CC2)cc1 |
| InChI | InChI=1S/C14H17ClN4O4S/c1-22-11-2-4-12(5-3-11)24(20,21)19-8-6-18(7-9-19)14-16-13(10-15)17-23-14/h2-5H,6-10H2,1H3 |
| InChIKey | YTXZLFBICIBIJK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|