About 3-bromopyridine;3-(2-ethoxyphenoxy)pyridine
3-bromopyridine;3-(2-ethoxyphenoxy)pyridine (PubChem CID 118385972) has the molecular formula C18H17BrN2O2
and a molecular weight of 373.25 g/mol. Its IUPAC name is 3-bromopyridine;3-(2-ethoxyphenoxy)pyridine.
Molecular Properties
| Compound Name | 3-bromopyridine;3-(2-ethoxyphenoxy)pyridine |
| PubChem CID | 118385972 |
| Molecular Formula | C18H17BrN2O2 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 3-bromopyridine;3-(2-ethoxyphenoxy)pyridine |
| SMILES | Brc1cccnc1.CCOc1ccccc1Oc1cccnc1 |
| InChI | InChI=1S/C13H13NO2.C5H4BrN/c1-2-15-12-7-3-4-8-13(12)16-11-6-5-9-14-10-11;6-5-2-1-3-7-4-5/h3-10H,2H2,1H3;1-4H |
| InChIKey | QIGGFSCRHNZATJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromopyridine;3-(2-ethoxyphenoxy)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromopyridine;3-(2-ethoxyphenoxy)pyridine?
The IUPAC name of 3-bromopyridine;3-(2-ethoxyphenoxy)pyridine (CID 118385972) is 3-bromopyridine;3-(2-ethoxyphenoxy)pyridine.
What is the SMILES notation for 3-bromopyridine;3-(2-ethoxyphenoxy)pyridine?
The canonical SMILES for 3-bromopyridine;3-(2-ethoxyphenoxy)pyridine is Brc1cccnc1.CCOc1ccccc1Oc1cccnc1.
What is the InChIKey of 3-bromopyridine;3-(2-ethoxyphenoxy)pyridine?
The InChIKey is QIGGFSCRHNZATJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO2.C5H4BrN/c1-2-15-12-7-3-4-8-13(12)16-11-6-5-9-14-10-11;6-5-2-1-3-7-4-5/h3-10H,2H2,1H3;1-4H.
What are the key properties of 3-bromopyridine;3-(2-ethoxyphenoxy)pyridine?
3-bromopyridine;3-(2-ethoxyphenoxy)pyridine has a molecular weight of 373.25 g/mol, XLogP of 5.12, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromopyridine;3-(2-ethoxyphenoxy)pyridine is sourced from PubChem (CID 118385972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).