About 5-bromo-2-methyl-1,3-benzothiazol-7-ol
5-bromo-2-methyl-1,3-benzothiazol-7-ol (PubChem CID 118386441) has the molecular formula C8H6BrNOS
and a molecular weight of 244.11 g/mol. Its IUPAC name is 5-bromo-2-methyl-1,3-benzothiazol-7-ol.
Molecular Properties
| Compound Name | 5-bromo-2-methyl-1,3-benzothiazol-7-ol |
| PubChem CID | 118386441 |
| Molecular Formula | C8H6BrNOS |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 242.94 |
| IUPAC Name | 5-bromo-2-methyl-1,3-benzothiazol-7-ol |
| SMILES | Cc1nc2cc(Br)cc(O)c2s1 |
| InChI | InChI=1S/C8H6BrNOS/c1-4-10-6-2-5(9)3-7(11)8(6)12-4/h2-3,11H,1H3 |
| InChIKey | PRKACADGIQCACY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-2-methyl-1,3-benzothiazol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methyl-1,3-benzothiazol-7-ol?
The IUPAC name of 5-bromo-2-methyl-1,3-benzothiazol-7-ol (CID 118386441) is 5-bromo-2-methyl-1,3-benzothiazol-7-ol.
What is the SMILES notation for 5-bromo-2-methyl-1,3-benzothiazol-7-ol?
The canonical SMILES for 5-bromo-2-methyl-1,3-benzothiazol-7-ol is Cc1nc2cc(Br)cc(O)c2s1.
What is the InChIKey of 5-bromo-2-methyl-1,3-benzothiazol-7-ol?
The InChIKey is PRKACADGIQCACY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrNOS/c1-4-10-6-2-5(9)3-7(11)8(6)12-4/h2-3,11H,1H3.
What are the key properties of 5-bromo-2-methyl-1,3-benzothiazol-7-ol?
5-bromo-2-methyl-1,3-benzothiazol-7-ol has a molecular weight of 244.11 g/mol, XLogP of 3.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methyl-1,3-benzothiazol-7-ol is sourced from PubChem (CID 118386441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).