About 7-methoxy-1-methyl-9-pentylpyrido[3,4-b]indole
7-methoxy-1-methyl-9-pentylpyrido[3,4-b]indole (PubChem CID 118386818) has the molecular formula C18H22N2O
and a molecular weight of 282.39 g/mol. Its IUPAC name is 7-methoxy-1-methyl-9-pentylpyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 7-methoxy-1-methyl-9-pentylpyrido[3,4-b]indole |
| PubChem CID | 118386818 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 7-methoxy-1-methyl-9-pentylpyrido[3,4-b]indole |
| SMILES | CCCCCn1c2cc(OC)ccc2c2ccnc(C)c21 |
| InChI | InChI=1S/C18H22N2O/c1-4-5-6-11-20-17-12-14(21-3)7-8-15(17)16-9-10-19-13(2)18(16)20/h7-10,12H,4-6,11H2,1-3H3 |
| InChIKey | IYOCDYDCSSAFCW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-methoxy-1-methyl-9-pentylpyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-1-methyl-9-pentylpyrido[3,4-b]indole?
The IUPAC name of 7-methoxy-1-methyl-9-pentylpyrido[3,4-b]indole (CID 118386818) is 7-methoxy-1-methyl-9-pentylpyrido[3,4-b]indole.
What is the SMILES notation for 7-methoxy-1-methyl-9-pentylpyrido[3,4-b]indole?
The canonical SMILES for 7-methoxy-1-methyl-9-pentylpyrido[3,4-b]indole is CCCCCn1c2cc(OC)ccc2c2ccnc(C)c21.
What is the InChIKey of 7-methoxy-1-methyl-9-pentylpyrido[3,4-b]indole?
The InChIKey is IYOCDYDCSSAFCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O/c1-4-5-6-11-20-17-12-14(21-3)7-8-15(17)16-9-10-19-13(2)18(16)20/h7-10,12H,4-6,11H2,1-3H3.
What are the key properties of 7-methoxy-1-methyl-9-pentylpyrido[3,4-b]indole?
7-methoxy-1-methyl-9-pentylpyrido[3,4-b]indole has a molecular weight of 282.39 g/mol, XLogP of 4.70, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-1-methyl-9-pentylpyrido[3,4-b]indole is sourced from PubChem (CID 118386818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).