C25H21ClFNO3 — CID 118387344
benzyl 1-(5-chloro-2-prop-2-enoxyphenyl)-5-fluoro-1,3-dihydroisoindole-2-carboxylate (PubChem CID 118387344) has the molecular formula C25H21ClFNO3 and a molecular weight of 437.90 g/mol. Its IUPAC name is benzyl 1-(5-chloro-2-prop-2-enoxyphenyl)-5-fluoro-1,3-dihydroisoindole-2-carboxylate.
| Compound Name | benzyl 1-(5-chloro-2-prop-2-enoxyphenyl)-5-fluoro-1,3-dihydroisoindole-2-carboxylate |
|---|---|
| PubChem CID | 118387344 |
| Molecular Formula | C25H21ClFNO3 |
| Molecular Weight | 437.90 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | benzyl 1-(5-chloro-2-prop-2-enoxyphenyl)-5-fluoro-1,3-dihydroisoindole-2-carboxylate |
| SMILES | C=CCOc1ccc(Cl)cc1C1c2ccc(F)cc2CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H21ClFNO3/c1-2-12-30-23-11-8-19(26)14-22(23)24-21-10-9-20(27)13-18(21)15-28(24)25(29)31-16-17-6-4-3-5-7-17/h2-11,13-14,24H,1,12,15-16H2 |
| InChIKey | PGNDSRWZGYWXRH-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.90 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|