About azane;2,5-dimethyl-[1,3]oxazolo[5,4-b]pyridine
azane;2,5-dimethyl-[1,3]oxazolo[5,4-b]pyridine (PubChem CID 118387720) has the molecular formula C8H11N3O
and a molecular weight of 165.20 g/mol. Its IUPAC name is azane;2,5-dimethyl-[1,3]oxazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | azane;2,5-dimethyl-[1,3]oxazolo[5,4-b]pyridine |
| PubChem CID | 118387720 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | azane;2,5-dimethyl-[1,3]oxazolo[5,4-b]pyridine |
| SMILES | Cc1ccc2nc(C)oc2n1.N |
| InChI | InChI=1S/C8H8N2O.H3N/c1-5-3-4-7-8(9-5)11-6(2)10-7;/h3-4H,1-2H3;1H3 |
| InChIKey | RLERLEBLPJFUDS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azane;2,5-dimethyl-[1,3]oxazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2,5-dimethyl-[1,3]oxazolo[5,4-b]pyridine?
The IUPAC name of azane;2,5-dimethyl-[1,3]oxazolo[5,4-b]pyridine (CID 118387720) is azane;2,5-dimethyl-[1,3]oxazolo[5,4-b]pyridine.
What is the SMILES notation for azane;2,5-dimethyl-[1,3]oxazolo[5,4-b]pyridine?
The canonical SMILES for azane;2,5-dimethyl-[1,3]oxazolo[5,4-b]pyridine is Cc1ccc2nc(C)oc2n1.N.
What is the InChIKey of azane;2,5-dimethyl-[1,3]oxazolo[5,4-b]pyridine?
The InChIKey is RLERLEBLPJFUDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O.H3N/c1-5-3-4-7-8(9-5)11-6(2)10-7;/h3-4H,1-2H3;1H3.
What are the key properties of azane;2,5-dimethyl-[1,3]oxazolo[5,4-b]pyridine?
azane;2,5-dimethyl-[1,3]oxazolo[5,4-b]pyridine has a molecular weight of 165.20 g/mol, XLogP of 2.00, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2,5-dimethyl-[1,3]oxazolo[5,4-b]pyridine is sourced from PubChem (CID 118387720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).