About propane-1,3-diamine;pyrrole-2,5-dione
propane-1,3-diamine;pyrrole-2,5-dione (PubChem CID 118387813) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is propane-1,3-diamine;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | propane-1,3-diamine;pyrrole-2,5-dione |
| PubChem CID | 118387813 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | propane-1,3-diamine;pyrrole-2,5-dione |
| SMILES | NCCCN.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C4H3NO2.C3H10N2/c6-3-1-2-4(7)5-3;4-2-1-3-5/h1-2H,(H,5,6,7);1-5H2 |
| InChIKey | KIBISPKRTFXGHV-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze propane-1,3-diamine;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1,3-diamine;pyrrole-2,5-dione?
The IUPAC name of propane-1,3-diamine;pyrrole-2,5-dione (CID 118387813) is propane-1,3-diamine;pyrrole-2,5-dione.
What is the SMILES notation for propane-1,3-diamine;pyrrole-2,5-dione?
The canonical SMILES for propane-1,3-diamine;pyrrole-2,5-dione is NCCCN.O=C1C=CC(=O)N1.
What is the InChIKey of propane-1,3-diamine;pyrrole-2,5-dione?
The InChIKey is KIBISPKRTFXGHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2.C3H10N2/c6-3-1-2-4(7)5-3;4-2-1-3-5/h1-2H,(H,5,6,7);1-5H2.
What are the key properties of propane-1,3-diamine;pyrrole-2,5-dione?
propane-1,3-diamine;pyrrole-2,5-dione has a molecular weight of 171.20 g/mol, XLogP of -1.51, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1,3-diamine;pyrrole-2,5-dione is sourced from PubChem (CID 118387813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).