About N-[2-[(1R,2S)-2-piperidin-4-ylcyclopropyl]ethyl]-5-(tetrazol-1-yl)pyrimidin-2-amine
N-[2-[(1R,2S)-2-piperidin-4-ylcyclopropyl]ethyl]-5-(tetrazol-1-yl)pyrimidin-2-amine (PubChem CID 118387889) has the molecular formula C15H22N8
and a molecular weight of 314.40 g/mol. Its IUPAC name is N-[2-[(1R,2S)-2-piperidin-4-ylcyclopropyl]ethyl]-5-(tetrazol-1-yl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | N-[2-[(1R,2S)-2-piperidin-4-ylcyclopropyl]ethyl]-5-(tetrazol-1-yl)pyrimidin-2-amine |
| PubChem CID | 118387889 |
| Molecular Formula | C15H22N8 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | N-[2-[(1R,2S)-2-piperidin-4-ylcyclopropyl]ethyl]-5-(tetrazol-1-yl)pyrimidin-2-amine |
| SMILES | c1nc(NCC[C@H]2C[C@@H]2C2CCNCC2)ncc1-n1cnnn1 |
| InChI | InChI=1S/C15H22N8/c1-4-16-5-2-11(1)14-7-12(14)3-6-17-15-18-8-13(9-19-15)23-10-20-21-22-23/h8-12,14,16H,1-7H2,(H,17,18,19)/t12-,14+/m0/s1 |
| InChIKey | YMVDTQUBYRFSOR-GXTWGEPZSA-N |
| XLogP | 0.89 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze N-[2-[(1R,2S)-2-piperidin-4-ylcyclopropyl]ethyl]-5-(tetrazol-1-yl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(1R,2S)-2-piperidin-4-ylcyclopropyl]ethyl]-5-(tetrazol-1-yl)pyrimidin-2-amine?
The IUPAC name of N-[2-[(1R,2S)-2-piperidin-4-ylcyclopropyl]ethyl]-5-(tetrazol-1-yl)pyrimidin-2-amine (CID 118387889) is N-[2-[(1R,2S)-2-piperidin-4-ylcyclopropyl]ethyl]-5-(tetrazol-1-yl)pyrimidin-2-amine.
What is the SMILES notation for N-[2-[(1R,2S)-2-piperidin-4-ylcyclopropyl]ethyl]-5-(tetrazol-1-yl)pyrimidin-2-amine?
The canonical SMILES for N-[2-[(1R,2S)-2-piperidin-4-ylcyclopropyl]ethyl]-5-(tetrazol-1-yl)pyrimidin-2-amine is c1nc(NCC[C@H]2C[C@@H]2C2CCNCC2)ncc1-n1cnnn1.
What is the InChIKey of N-[2-[(1R,2S)-2-piperidin-4-ylcyclopropyl]ethyl]-5-(tetrazol-1-yl)pyrimidin-2-amine?
The InChIKey is YMVDTQUBYRFSOR-GXTWGEPZSA-N. The full InChI is InChI=1S/C15H22N8/c1-4-16-5-2-11(1)14-7-12(14)3-6-17-15-18-8-13(9-19-15)23-10-20-21-22-23/h8-12,14,16H,1-7H2,(H,17,18,19)/t12-,14+/m0/s1.
What are the key properties of N-[2-[(1R,2S)-2-piperidin-4-ylcyclopropyl]ethyl]-5-(tetrazol-1-yl)pyrimidin-2-amine?
N-[2-[(1R,2S)-2-piperidin-4-ylcyclopropyl]ethyl]-5-(tetrazol-1-yl)pyrimidin-2-amine has a molecular weight of 314.40 g/mol, XLogP of 0.89, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(1R,2S)-2-piperidin-4-ylcyclopropyl]ethyl]-5-(tetrazol-1-yl)pyrimidin-2-amine is sourced from PubChem (CID 118387889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).