C25H23F3N8O — CID 118388473
(3S,4R)-4-[[5-cyclopropyl-2-[2-[(3,4,6-trifluoro-2-pyridinyl)amino]-4-pyridinyl]pyrido[3,4-d]pyrimidin-4-yl]amino]piperidin-3-ol (PubChem CID 118388473) has the molecular formula C25H23F3N8O and a molecular weight of 508.51 g/mol. Its IUPAC name is (3S,4R)-4-[[5-cyclopropyl-2-[2-[(3,4,6-trifluoro-2-pyridinyl)amino]-4-pyridinyl]pyrido[3,4-d]pyrimidin-4-yl]amino]piperidin-3-ol.
| Compound Name | (3S,4R)-4-[[5-cyclopropyl-2-[2-[(3,4,6-trifluoro-2-pyridinyl)amino]-4-pyridinyl]pyrido[3,4-d]pyrimidin-4-yl]amino]piperidin-3-ol |
|---|---|
| PubChem CID | 118388473 |
| Molecular Formula | C25H23F3N8O |
| Molecular Weight | 508.51 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | (3S,4R)-4-[[5-cyclopropyl-2-[2-[(3,4,6-trifluoro-2-pyridinyl)amino]-4-pyridinyl]pyrido[3,4-d]pyrimidin-4-yl]amino]piperidin-3-ol |
| SMILES | O[C@H]1CNCC[C@H]1Nc1nc(-c2ccnc(Nc3nc(F)cc(F)c3F)c2)nc2cncc(C3CC3)c12 |
| InChI | InChI=1S/C25H23F3N8O/c26-15-8-19(27)34-25(22(15)28)35-20-7-13(3-6-31-20)23-33-17-10-30-9-14(12-1-2-12)21(17)24(36-23)32-16-4-5-29-11-18(16)37/h3,6-10,12,16,18,29,37H,1-2,4-5,11H2,(H,31,34,35)(H,32,33,36)/t16-,18+/m1/s1 |
| InChIKey | AXOCBIIMCJRTJJ-AEFFLSMTSA-N |
| XLogP | 3.65 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|