C29H28FN7O3 — CID 118388837
N-[amino-[7-[(2,4-dimethoxyphenyl)methyl]-4-methyl-2,5,7,9-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),3,5,8,10-pentaen-12-yl]methylidene]-3-cyclobutyl-5-fluoropyridine-4-carboxamide (PubChem CID 118388837) has the molecular formula C29H28FN7O3 and a molecular weight of 541.59 g/mol. Its IUPAC name is N-[amino-[7-[(2,4-dimethoxyphenyl)methyl]-4-methyl-2,5,7,9-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),3,5,8,10-pentaen-12-yl]methylidene]-3-cyclobutyl-5-fluoropyridine-4-carboxamide.
| Compound Name | N-[amino-[7-[(2,4-dimethoxyphenyl)methyl]-4-methyl-2,5,7,9-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),3,5,8,10-pentaen-12-yl]methylidene]-3-cyclobutyl-5-fluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 118388837 |
| Molecular Formula | C29H28FN7O3 |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | N-[amino-[7-[(2,4-dimethoxyphenyl)methyl]-4-methyl-2,5,7,9-tetrazatricyclo[6.4.0.02,6]dodeca-1(12),3,5,8,10-pentaen-12-yl]methylidene]-3-cyclobutyl-5-fluoropyridine-4-carboxamide |
| SMILES | COc1ccc(Cn2c3nccc(/C(N)=N/C(=O)c4c(F)cncc4C4CCC4)c3n3cc(C)nc23)c(OC)c1 |
| InChI | InChI=1S/C29H28FN7O3/c1-16-14-36-25-20(26(31)35-28(38)24-21(17-5-4-6-17)12-32-13-22(24)30)9-10-33-27(25)37(29(36)34-16)15-18-7-8-19(39-2)11-23(18)40-3/h7-14,17H,4-6,15H2,1-3H3,(H2,31,35,38) |
| InChIKey | UCYQAWVMCLWQBS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 121.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|