C16H19Br3ClN3 — CID 118389032
5,6,7-tribromo-2-(1-methylpiperidin-4-yl)-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene;hydrochloride (PubChem CID 118389032) has the molecular formula C16H19Br3ClN3 and a molecular weight of 528.51 g/mol. Its IUPAC name is 5,6,7-tribromo-2-(1-methylpiperidin-4-yl)-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene;hydrochloride.
| Compound Name | 5,6,7-tribromo-2-(1-methylpiperidin-4-yl)-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene;hydrochloride |
|---|---|
| PubChem CID | 118389032 |
| Molecular Formula | C16H19Br3ClN3 |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 524.88 |
| IUPAC Name | 5,6,7-tribromo-2-(1-methylpiperidin-4-yl)-1,3-diazatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraene;hydrochloride |
| SMILES | CN1CCC(c2nc3c(Br)c(Br)c(Br)c4c3n2CCC4)CC1.Cl |
| InChI | InChI=1S/C16H18Br3N3.ClH/c1-21-7-4-9(5-8-21)16-20-14-13(19)12(18)11(17)10-3-2-6-22(16)15(10)14;/h9H,2-8H2,1H3;1H |
| InChIKey | XQRDRPCEORLNLO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|