C14H26O — CID 118389071
1-(1,3,4-trimethylcyclohex-3-en-1-yl)pentan-1-ol (PubChem CID 118389071) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-(1,3,4-trimethylcyclohex-3-en-1-yl)pentan-1-ol.
| Compound Name | 1-(1,3,4-trimethylcyclohex-3-en-1-yl)pentan-1-ol |
|---|---|
| PubChem CID | 118389071 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 1-(1,3,4-trimethylcyclohex-3-en-1-yl)pentan-1-ol |
| SMILES | CCCCC(O)C1(C)CCC(C)=C(C)C1 |
| InChI | InChI=1S/C14H26O/c1-5-6-7-13(15)14(4)9-8-11(2)12(3)10-14/h13,15H,5-10H2,1-4H3 |
| InChIKey | KGWCOVULEXRJHT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|