About 2,4-bis(4-chlorophenyl)-8-methoxy-5,6-dihydrobenzo[h]quinazoline
2,4-bis(4-chlorophenyl)-8-methoxy-5,6-dihydrobenzo[h]quinazoline (PubChem CID 11838916) has the molecular formula C25H18Cl2N2O
and a molecular weight of 433.34 g/mol. Its IUPAC name is 2,4-bis(4-chlorophenyl)-8-methoxy-5,6-dihydrobenzo[h]quinazoline.
Molecular Properties
| Compound Name | 2,4-bis(4-chlorophenyl)-8-methoxy-5,6-dihydrobenzo[h]quinazoline |
| PubChem CID | 11838916 |
| Molecular Formula | C25H18Cl2N2O |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 2,4-bis(4-chlorophenyl)-8-methoxy-5,6-dihydrobenzo[h]quinazoline |
| SMILES | COc1ccc2c(c1)CCc1c(-c3ccc(Cl)cc3)nc(-c3ccc(Cl)cc3)nc1-2 |
| InChI | InChI=1S/C25H18Cl2N2O/c1-30-20-11-13-21-17(14-20)6-12-22-23(15-2-7-18(26)8-3-15)28-25(29-24(21)22)16-4-9-19(27)10-5-16/h2-5,7-11,13-14H,6,12H2,1H3 |
| InChIKey | YATXKXFJEHQJHO-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-bis(4-chlorophenyl)-8-methoxy-5,6-dihydrobenzo[h]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(4-chlorophenyl)-8-methoxy-5,6-dihydrobenzo[h]quinazoline?
The IUPAC name of 2,4-bis(4-chlorophenyl)-8-methoxy-5,6-dihydrobenzo[h]quinazoline (CID 11838916) is 2,4-bis(4-chlorophenyl)-8-methoxy-5,6-dihydrobenzo[h]quinazoline.
What is the SMILES notation for 2,4-bis(4-chlorophenyl)-8-methoxy-5,6-dihydrobenzo[h]quinazoline?
The canonical SMILES for 2,4-bis(4-chlorophenyl)-8-methoxy-5,6-dihydrobenzo[h]quinazoline is COc1ccc2c(c1)CCc1c(-c3ccc(Cl)cc3)nc(-c3ccc(Cl)cc3)nc1-2.
What is the InChIKey of 2,4-bis(4-chlorophenyl)-8-methoxy-5,6-dihydrobenzo[h]quinazoline?
The InChIKey is YATXKXFJEHQJHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18Cl2N2O/c1-30-20-11-13-21-17(14-20)6-12-22-23(15-2-7-18(26)8-3-15)28-25(29-24(21)22)16-4-9-19(27)10-5-16/h2-5,7-11,13-14H,6,12H2,1H3.
What are the key properties of 2,4-bis(4-chlorophenyl)-8-methoxy-5,6-dihydrobenzo[h]quinazoline?
2,4-bis(4-chlorophenyl)-8-methoxy-5,6-dihydrobenzo[h]quinazoline has a molecular weight of 433.34 g/mol, XLogP of 6.89, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(4-chlorophenyl)-8-methoxy-5,6-dihydrobenzo[h]quinazoline is sourced from PubChem (CID 11838916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).