About 2,5-diphenylthiophene-3,4-diamine
2,5-diphenylthiophene-3,4-diamine (PubChem CID 118389679) has the molecular formula C16H14N2S
and a molecular weight of 266.37 g/mol. Its IUPAC name is 2,5-diphenylthiophene-3,4-diamine.
Molecular Properties
| Compound Name | 2,5-diphenylthiophene-3,4-diamine |
| PubChem CID | 118389679 |
| Molecular Formula | C16H14N2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2,5-diphenylthiophene-3,4-diamine |
| SMILES | Nc1c(-c2ccccc2)sc(-c2ccccc2)c1N |
| InChI | InChI=1S/C16H14N2S/c17-13-14(18)16(12-9-5-2-6-10-12)19-15(13)11-7-3-1-4-8-11/h1-10H,17-18H2 |
| InChIKey | HZDXSLSFRHXJQU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,5-diphenylthiophene-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diphenylthiophene-3,4-diamine?
The IUPAC name of 2,5-diphenylthiophene-3,4-diamine (CID 118389679) is 2,5-diphenylthiophene-3,4-diamine.
What is the SMILES notation for 2,5-diphenylthiophene-3,4-diamine?
The canonical SMILES for 2,5-diphenylthiophene-3,4-diamine is Nc1c(-c2ccccc2)sc(-c2ccccc2)c1N.
What is the InChIKey of 2,5-diphenylthiophene-3,4-diamine?
The InChIKey is HZDXSLSFRHXJQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2S/c17-13-14(18)16(12-9-5-2-6-10-12)19-15(13)11-7-3-1-4-8-11/h1-10H,17-18H2.
What are the key properties of 2,5-diphenylthiophene-3,4-diamine?
2,5-diphenylthiophene-3,4-diamine has a molecular weight of 266.37 g/mol, XLogP of 4.25, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diphenylthiophene-3,4-diamine is sourced from PubChem (CID 118389679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).