C17H21ClF3N7 — CID 118390087
5-chloro-2-N-(1-methylpyrazol-4-yl)-4-N-[2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]pyrimidine-2,4-diamine (PubChem CID 118390087) has the molecular formula C17H21ClF3N7 and a molecular weight of 415.85 g/mol. Its IUPAC name is 5-chloro-2-N-(1-methylpyrazol-4-yl)-4-N-[2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-(1-methylpyrazol-4-yl)-4-N-[2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 118390087 |
| Molecular Formula | C17H21ClF3N7 |
| Molecular Weight | 415.85 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 5-chloro-2-N-(1-methylpyrazol-4-yl)-4-N-[2-(2,2,2-trifluoroethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-yl]pyrimidine-2,4-diamine |
| SMILES | Cn1cc(Nc2ncc(Cl)c(NC3CC4CN(CC(F)(F)F)CC4C3)n2)cn1 |
| InChI | InChI=1S/C17H21ClF3N7/c1-27-8-13(4-23-27)25-16-22-5-14(18)15(26-16)24-12-2-10-6-28(7-11(10)3-12)9-17(19,20)21/h4-5,8,10-12H,2-3,6-7,9H2,1H3,(H2,22,24,25,26) |
| InChIKey | OUQLXOHGWYNDKX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.85 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |