C56H40N2O2 — CID 118390342
11-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]-1-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9,11,13(21),14,16,18-nonaene-2,20-dione (PubChem CID 118390342) has the molecular formula C56H40N2O2 and a molecular weight of 772.95 g/mol. Its IUPAC name is 11-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]-1-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9,11,13(21),14,16,18-nonaene-2,20-dione.
| Compound Name | 11-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]-1-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9,11,13(21),14,16,18-nonaene-2,20-dione |
|---|---|
| PubChem CID | 118390342 |
| Molecular Formula | C56H40N2O2 |
| Molecular Weight | 772.95 g/mol |
| Exact Mass | 772.31 |
| IUPAC Name | 11-[4-[bis(9,9-dimethylfluoren-2-yl)amino]phenyl]-1-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9,11,13(21),14,16,18-nonaene-2,20-dione |
| SMILES | CC1(C)c2ccccc2-c2ccc(N(c3ccc(-c4cc5c6ccccc6c(=O)n6c(=O)c7ccccc7c(c4)c56)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C56H40N2O2/c1-55(2)48-19-11-9-15-40(48)42-27-25-36(31-50(42)55)57(37-26-28-43-41-16-10-12-20-49(41)56(3,4)51(43)32-37)35-23-21-33(22-24-35)34-29-46-38-13-5-7-17-44(38)53(59)58-52(46)47(30-34)39-14-6-8-18-45(39)54(58)60/h5-32H,1-4H3 |
| InChIKey | QAMSKDOAJSAAOF-UHFFFAOYSA-N |
| XLogP | 13.31 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.95 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|