C34H19N5O2 — CID 118390362
11-(3,5-diphenylphenyl)-1,4,7,15,18-pentazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9,11,13(21),14,16,18-nonaene-2,20-dione (PubChem CID 118390362) has the molecular formula C34H19N5O2 and a molecular weight of 529.56 g/mol. Its IUPAC name is 11-(3,5-diphenylphenyl)-1,4,7,15,18-pentazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9,11,13(21),14,16,18-nonaene-2,20-dione.
| Compound Name | 11-(3,5-diphenylphenyl)-1,4,7,15,18-pentazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9,11,13(21),14,16,18-nonaene-2,20-dione |
|---|---|
| PubChem CID | 118390362 |
| Molecular Formula | C34H19N5O2 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | 11-(3,5-diphenylphenyl)-1,4,7,15,18-pentazapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3,5,7,9,11,13(21),14,16,18-nonaene-2,20-dione |
| SMILES | O=c1c2nccnc2c2cc(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)cc3c4nccnc4c(=O)n1c23 |
| InChI | InChI=1S/C34H19N5O2/c40-33-30-28(35-11-13-37-30)26-18-25(19-27-29-31(38-14-12-36-29)34(41)39(33)32(26)27)24-16-22(20-7-3-1-4-8-20)15-23(17-24)21-9-5-2-6-10-21/h1-19H |
| InChIKey | KAYJSRSAPXYQKD-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 90.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|