C45H82N2 — CID 118391266
4-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]imino-N,N-dimethylcyclohexan-1-amine (PubChem CID 118391266) has the molecular formula C45H82N2 and a molecular weight of 651.16 g/mol. Its IUPAC name is 4-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]imino-N,N-dimethylcyclohexan-1-amine.
| Compound Name | 4-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]imino-N,N-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 118391266 |
| Molecular Formula | C45H82N2 |
| Molecular Weight | 651.16 g/mol |
| Exact Mass | 650.65 |
| IUPAC Name | 4-[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-yl]imino-N,N-dimethylcyclohexan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)N=C1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C45H82N2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-43(46-44-39-41-45(42-40-44)47(3)4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,43,45H,5-12,17-18,23-42H2,1-4H3/b15-13-,16-14-,21-19-,22-20-,46-44- |
| InChIKey | HEVCEJHJUSERRA-QTJJWTIPSA-N |
| XLogP | 14.71 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.16 |
| LogP ≤ 5 | 14.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|