C11H20N2O — CID 118391800
2-tert-butyl-5-(2,2-dimethylpropyl)-1,3,4-oxadiazole (PubChem CID 118391800) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-tert-butyl-5-(2,2-dimethylpropyl)-1,3,4-oxadiazole.
| Compound Name | 2-tert-butyl-5-(2,2-dimethylpropyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 118391800 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 2-tert-butyl-5-(2,2-dimethylpropyl)-1,3,4-oxadiazole |
| SMILES | CC(C)(C)Cc1nnc(C(C)(C)C)o1 |
| InChI | InChI=1S/C11H20N2O/c1-10(2,3)7-8-12-13-9(14-8)11(4,5)6/h7H2,1-6H3 |
| InChIKey | MGQMDVCKOABIAH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |