C21H34N3O6P — CID 118391875
tert-butyl 4-[5-(2-diethoxyphosphorylacetyl)-2-methylpyrimidin-4-yl]piperidine-1-carboxylate (PubChem CID 118391875) has the molecular formula C21H34N3O6P and a molecular weight of 455.49 g/mol. Its IUPAC name is tert-butyl 4-[5-(2-diethoxyphosphorylacetyl)-2-methylpyrimidin-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[5-(2-diethoxyphosphorylacetyl)-2-methylpyrimidin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118391875 |
| Molecular Formula | C21H34N3O6P |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | tert-butyl 4-[5-(2-diethoxyphosphorylacetyl)-2-methylpyrimidin-4-yl]piperidine-1-carboxylate |
| SMILES | CCOP(=O)(CC(=O)c1cnc(C)nc1C1CCN(C(=O)OC(C)(C)C)CC1)OCC |
| InChI | InChI=1S/C21H34N3O6P/c1-7-28-31(27,29-8-2)14-18(25)17-13-22-15(3)23-19(17)16-9-11-24(12-10-16)20(26)30-21(4,5)6/h13,16H,7-12,14H2,1-6H3 |
| InChIKey | ZTHHIJMPHXNWAF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 107.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|