About 4-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenol
4-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenol (PubChem CID 118392595) has the molecular formula C20H20N2O4
and a molecular weight of 352.39 g/mol. Its IUPAC name is 4-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenol.
Molecular Properties
| Compound Name | 4-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenol |
| PubChem CID | 118392595 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 4-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenol |
| SMILES | COc1cc(-c2cc(-c3ccc(O)cc3)cnc2N)cc(OC)c1OC |
| InChI | InChI=1S/C20H20N2O4/c1-24-17-9-13(10-18(25-2)19(17)26-3)16-8-14(11-22-20(16)21)12-4-6-15(23)7-5-12/h4-11,23H,1-3H3,(H2,21,22) |
| InChIKey | PCGVHKSBFKSOEH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 86.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenol?
The IUPAC name of 4-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenol (CID 118392595) is 4-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenol.
What is the SMILES notation for 4-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenol?
The canonical SMILES for 4-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenol is COc1cc(-c2cc(-c3ccc(O)cc3)cnc2N)cc(OC)c1OC.
What is the InChIKey of 4-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenol?
The InChIKey is PCGVHKSBFKSOEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O4/c1-24-17-9-13(10-18(25-2)19(17)26-3)16-8-14(11-22-20(16)21)12-4-6-15(23)7-5-12/h4-11,23H,1-3H3,(H2,21,22).
What are the key properties of 4-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenol?
4-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenol has a molecular weight of 352.39 g/mol, XLogP of 3.73, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-amino-5-(3,4,5-trimethoxyphenyl)-3-pyridinyl]phenol is sourced from PubChem (CID 118392595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).