C17H20F3N3O — CID 118392637
2-[(3,3-difluorocyclopentyl)amino]-5-fluoro-N-[(3R)-3-methylpent-1-yn-3-yl]pyridine-3-carboxamide (PubChem CID 118392637) has the molecular formula C17H20F3N3O and a molecular weight of 339.36 g/mol. Its IUPAC name is 2-[(3,3-difluorocyclopentyl)amino]-5-fluoro-N-[(3R)-3-methylpent-1-yn-3-yl]pyridine-3-carboxamide.
| Compound Name | 2-[(3,3-difluorocyclopentyl)amino]-5-fluoro-N-[(3R)-3-methylpent-1-yn-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118392637 |
| Molecular Formula | C17H20F3N3O |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-[(3,3-difluorocyclopentyl)amino]-5-fluoro-N-[(3R)-3-methylpent-1-yn-3-yl]pyridine-3-carboxamide |
| SMILES | C#C[C@@](C)(CC)NC(=O)c1cc(F)cnc1NC1CCC(F)(F)C1 |
| InChI | InChI=1S/C17H20F3N3O/c1-4-16(3,5-2)23-15(24)13-8-11(18)10-21-14(13)22-12-6-7-17(19,20)9-12/h1,8,10,12H,5-7,9H2,2-3H3,(H,21,22)(H,23,24)/t12?,16-/m0/s1 |
| InChIKey | AQIOEBFHXFUGFA-INSVYWFGSA-N |
| XLogP | 3.35 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|