C12H8ClF3N2O — CID 118392804
3-(1-methylpyrazol-3-yl)-4-(trifluoromethyl)benzoyl chloride (PubChem CID 118392804) has the molecular formula C12H8ClF3N2O and a molecular weight of 288.66 g/mol. Its IUPAC name is 3-(1-methylpyrazol-3-yl)-4-(trifluoromethyl)benzoyl chloride.
| Compound Name | 3-(1-methylpyrazol-3-yl)-4-(trifluoromethyl)benzoyl chloride |
|---|---|
| PubChem CID | 118392804 |
| Molecular Formula | C12H8ClF3N2O |
| Molecular Weight | 288.66 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 3-(1-methylpyrazol-3-yl)-4-(trifluoromethyl)benzoyl chloride |
| SMILES | Cn1ccc(-c2cc(C(=O)Cl)ccc2C(F)(F)F)n1 |
| InChI | InChI=1S/C12H8ClF3N2O/c1-18-5-4-10(17-18)8-6-7(11(13)19)2-3-9(8)12(14,15)16/h2-6H,1H3 |
| InChIKey | NNBZUHHUYBLWIC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.66 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|