C23H16F4N8O — CID 118393414
N-[2-(azidomethyl)-4-phenylpyrimidin-5-yl]-2-fluoro-5-(1-methylpyrazol-3-yl)-4-(trifluoromethyl)benzamide (PubChem CID 118393414) has the molecular formula C23H16F4N8O and a molecular weight of 496.43 g/mol. Its IUPAC name is N-[2-(azidomethyl)-4-phenylpyrimidin-5-yl]-2-fluoro-5-(1-methylpyrazol-3-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(azidomethyl)-4-phenylpyrimidin-5-yl]-2-fluoro-5-(1-methylpyrazol-3-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118393414 |
| Molecular Formula | C23H16F4N8O |
| Molecular Weight | 496.43 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | N-[2-(azidomethyl)-4-phenylpyrimidin-5-yl]-2-fluoro-5-(1-methylpyrazol-3-yl)-4-(trifluoromethyl)benzamide |
| SMILES | Cn1ccc(-c2cc(C(=O)Nc3cnc(CN=[N+]=[N-])nc3-c3ccccc3)c(F)cc2C(F)(F)F)n1 |
| InChI | InChI=1S/C23H16F4N8O/c1-35-8-7-18(33-35)14-9-15(17(24)10-16(14)23(25,26)27)22(36)31-19-11-29-20(12-30-34-28)32-21(19)13-5-3-2-4-6-13/h2-11H,12H2,1H3,(H,31,36) |
| InChIKey | WEGXJTUJELQXAX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.43 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|