C14H22N4O4 — CID 118394547
7-O-tert-butyl 2-O-ethyl 5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine-2,7-dicarboxylate (PubChem CID 118394547) has the molecular formula C14H22N4O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 7-O-tert-butyl 2-O-ethyl 5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine-2,7-dicarboxylate.
| Compound Name | 7-O-tert-butyl 2-O-ethyl 5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine-2,7-dicarboxylate |
|---|---|
| PubChem CID | 118394547 |
| Molecular Formula | C14H22N4O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 7-O-tert-butyl 2-O-ethyl 5,6,8,9-tetrahydro-[1,2,4]triazolo[1,5-d][1,4]diazepine-2,7-dicarboxylate |
| SMILES | CCOC(=O)c1nc2n(n1)CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C14H22N4O4/c1-5-21-12(19)11-15-10-6-7-17(8-9-18(10)16-11)13(20)22-14(2,3)4/h5-9H2,1-4H3 |
| InChIKey | QBQAEYBKYFMRCL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 86.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |