C22H23ClN2O4 — CID 118394588
2-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indole-2-carbonyl]amino]acetic acid (PubChem CID 118394588) has the molecular formula C22H23ClN2O4 and a molecular weight of 414.89 g/mol. Its IUPAC name is 2-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indole-2-carbonyl]amino]acetic acid.
| Compound Name | 2-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indole-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 118394588 |
| Molecular Formula | C22H23ClN2O4 |
| Molecular Weight | 414.89 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 2-[[3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-1H-indole-2-carbonyl]amino]acetic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)NCC(=O)O)[nH]c3ccccc23)cc(C)c1Cl |
| InChI | InChI=1S/C22H23ClN2O4/c1-13-10-15(11-14(2)20(13)23)29-9-5-7-17-16-6-3-4-8-18(16)25-21(17)22(28)24-12-19(26)27/h3-4,6,8,10-11,25H,5,7,9,12H2,1-2H3,(H,24,28)(H,26,27) |
| InChIKey | PXJFLZFCYWEHHY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.89 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|