C36H38Cl2N6O4 — CID 118394622
6-[4-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]piperazin-1-yl]pyridine-3-carboxylic acid (PubChem CID 118394622) has the molecular formula C36H38Cl2N6O4 and a molecular weight of 689.64 g/mol. Its IUPAC name is 6-[4-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]piperazin-1-yl]pyridine-3-carboxylic acid.
| Compound Name | 6-[4-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]piperazin-1-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118394622 |
| Molecular Formula | C36H38Cl2N6O4 |
| Molecular Weight | 689.64 g/mol |
| Exact Mass | 688.23 |
| IUPAC Name | 6-[4-[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]piperazin-1-yl]pyridine-3-carboxylic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)N3CCN(c4ccc(C(=O)O)cn4)CC3)[nH]c3c(-c4c(C)nn(C)c4C)c(Cl)ccc23)cc(C)c1Cl |
| InChI | InChI=1S/C36H38Cl2N6O4/c1-20-17-25(18-21(2)32(20)38)48-16-6-7-26-27-9-10-28(37)31(30-22(3)41-42(5)23(30)4)33(27)40-34(26)35(45)44-14-12-43(13-15-44)29-11-8-24(19-39-29)36(46)47/h8-11,17-19,40H,6-7,12-16H2,1-5H3,(H,46,47) |
| InChIKey | YSYOAZUYFIJENI-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 116.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.64 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|