C32H31Cl2N5O4 — CID 118394880
4-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]pyridine-2-carboxylic acid (PubChem CID 118394880) has the molecular formula C32H31Cl2N5O4 and a molecular weight of 620.54 g/mol. Its IUPAC name is 4-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 4-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 118394880 |
| Molecular Formula | C32H31Cl2N5O4 |
| Molecular Weight | 620.54 g/mol |
| Exact Mass | 619.18 |
| IUPAC Name | 4-[[6-chloro-3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-7-(1,3,5-trimethylpyrazol-4-yl)-1H-indole-2-carbonyl]amino]pyridine-2-carboxylic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)Nc3ccnc(C(=O)O)c3)[nH]c3c(-c4c(C)nn(C)c4C)c(Cl)ccc23)cc(C)c1Cl |
| InChI | InChI=1S/C32H31Cl2N5O4/c1-16-13-21(14-17(2)28(16)34)43-12-6-7-22-23-8-9-24(33)27(26-18(3)38-39(5)19(26)4)29(23)37-30(22)31(40)36-20-10-11-35-25(15-20)32(41)42/h8-11,13-15,37H,6-7,12H2,1-5H3,(H,41,42)(H,35,36,40) |
| InChIKey | DJIOCJVLGOFDKN-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.54 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|