About (2-hydroxy-3-oxopentyl)-trimethylazanium;1H-imidazole
(2-hydroxy-3-oxopentyl)-trimethylazanium;1H-imidazole (PubChem CID 118395063) has the molecular formula C11H22N3O2+
and a molecular weight of 228.32 g/mol. Its IUPAC name is (2-hydroxy-3-oxopentyl)-trimethylazanium;1H-imidazole.
Molecular Properties
| Compound Name | (2-hydroxy-3-oxopentyl)-trimethylazanium;1H-imidazole |
| PubChem CID | 118395063 |
| Molecular Formula | C11H22N3O2+ |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (2-hydroxy-3-oxopentyl)-trimethylazanium;1H-imidazole |
| SMILES | CCC(=O)C(O)C[N+](C)(C)C.c1c[nH]cn1 |
| InChI | InChI=1S/C8H18NO2.C3H4N2/c1-5-7(10)8(11)6-9(2,3)4;1-2-5-3-4-1/h8,11H,5-6H2,1-4H3;1-3H,(H,4,5)/q+1; |
| InChIKey | WDQMUENBMYHBRI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-3-oxopentyl)-trimethylazanium;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-3-oxopentyl)-trimethylazanium;1H-imidazole?
The IUPAC name of (2-hydroxy-3-oxopentyl)-trimethylazanium;1H-imidazole (CID 118395063) is (2-hydroxy-3-oxopentyl)-trimethylazanium;1H-imidazole.
What is the SMILES notation for (2-hydroxy-3-oxopentyl)-trimethylazanium;1H-imidazole?
The canonical SMILES for (2-hydroxy-3-oxopentyl)-trimethylazanium;1H-imidazole is CCC(=O)C(O)C[N+](C)(C)C.c1c[nH]cn1.
What is the InChIKey of (2-hydroxy-3-oxopentyl)-trimethylazanium;1H-imidazole?
The InChIKey is WDQMUENBMYHBRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18NO2.C3H4N2/c1-5-7(10)8(11)6-9(2,3)4;1-2-5-3-4-1/h8,11H,5-6H2,1-4H3;1-3H,(H,4,5)/q+1;.
What are the key properties of (2-hydroxy-3-oxopentyl)-trimethylazanium;1H-imidazole?
(2-hydroxy-3-oxopentyl)-trimethylazanium;1H-imidazole has a molecular weight of 228.32 g/mol, XLogP of 0.44, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-3-oxopentyl)-trimethylazanium;1H-imidazole is sourced from PubChem (CID 118395063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).