C15H13BrF4N4O — CID 118395275
N-amino-N'-[(2S)-3-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]methanimidamide (PubChem CID 118395275) has the molecular formula C15H13BrF4N4O and a molecular weight of 421.19 g/mol. Its IUPAC name is N-amino-N'-[(2S)-3-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]methanimidamide.
| Compound Name | N-amino-N'-[(2S)-3-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]methanimidamide |
|---|---|
| PubChem CID | 118395275 |
| Molecular Formula | C15H13BrF4N4O |
| Molecular Weight | 421.19 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | N-amino-N'-[(2S)-3-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]methanimidamide |
| SMILES | NN/C=N/C[C@@](O)(c1ccc(F)cc1F)C(F)(F)c1ccc(Br)cn1 |
| InChI | InChI=1S/C15H13BrF4N4O/c16-9-1-4-13(23-6-9)15(19,20)14(25,7-22-8-24-21)11-3-2-10(17)5-12(11)18/h1-6,8,25H,7,21H2,(H,22,24)/t14-/m1/s1 |
| InChIKey | YQZJORJHHMYNQW-CQSZACIVSA-N |
| XLogP | 2.59 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|