C22H21N5O7S — CID 118395679
ethyl 6,8-diacetamido-7-(4-nitrophenoxy)-3aH-imidazo[2,1-b][1,3]benzothiazole-3-carboxylate (PubChem CID 118395679) has the molecular formula C22H21N5O7S and a molecular weight of 499.51 g/mol. Its IUPAC name is ethyl 6,8-diacetamido-7-(4-nitrophenoxy)-3aH-imidazo[2,1-b][1,3]benzothiazole-3-carboxylate.
| Compound Name | ethyl 6,8-diacetamido-7-(4-nitrophenoxy)-3aH-imidazo[2,1-b][1,3]benzothiazole-3-carboxylate |
|---|---|
| PubChem CID | 118395679 |
| Molecular Formula | C22H21N5O7S |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | ethyl 6,8-diacetamido-7-(4-nitrophenoxy)-3aH-imidazo[2,1-b][1,3]benzothiazole-3-carboxylate |
| SMILES | CCOC(=O)N1C=CN2c3c(cc(NC(C)=O)c(Oc4ccc([N+](=O)[O-])cc4)c3NC(C)=O)SC12 |
| InChI | InChI=1S/C22H21N5O7S/c1-4-33-22(30)26-10-9-25-19-17(35-21(25)26)11-16(23-12(2)28)20(18(19)24-13(3)29)34-15-7-5-14(6-8-15)27(31)32/h5-11,21H,4H2,1-3H3,(H,23,28)(H,24,29) |
| InChIKey | PNFNHCKTDCUFSR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 143.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|