C24H14N2O8 — CID 118395724
5-[4-(3,5-dicarboxyphenyl)phthalazin-1-yl]benzene-1,3-dicarboxylic acid (PubChem CID 118395724) has the molecular formula C24H14N2O8 and a molecular weight of 458.38 g/mol. Its IUPAC name is 5-[4-(3,5-dicarboxyphenyl)phthalazin-1-yl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[4-(3,5-dicarboxyphenyl)phthalazin-1-yl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 118395724 |
| Molecular Formula | C24H14N2O8 |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 5-[4-(3,5-dicarboxyphenyl)phthalazin-1-yl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)cc(-c2nnc(-c3cc(C(=O)O)cc(C(=O)O)c3)c3ccccc23)c1 |
| InChI | InChI=1S/C24H14N2O8/c27-21(28)13-5-11(6-14(9-13)22(29)30)19-17-3-1-2-4-18(17)20(26-25-19)12-7-15(23(31)32)10-16(8-12)24(33)34/h1-10H,(H,27,28)(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | HZVRKFQRRWNXNM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 174.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |