C19H22BrN — CID 118395762
(2S)-2-(4-bromophenyl)-1-[(1R)-1-phenylethyl]piperidine (PubChem CID 118395762) has the molecular formula C19H22BrN and a molecular weight of 344.30 g/mol. Its IUPAC name is (2S)-2-(4-bromophenyl)-1-[(1R)-1-phenylethyl]piperidine.
| Compound Name | (2S)-2-(4-bromophenyl)-1-[(1R)-1-phenylethyl]piperidine |
|---|---|
| PubChem CID | 118395762 |
| Molecular Formula | C19H22BrN |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (2S)-2-(4-bromophenyl)-1-[(1R)-1-phenylethyl]piperidine |
| SMILES | C[C@H](c1ccccc1)N1CCCC[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H22BrN/c1-15(16-7-3-2-4-8-16)21-14-6-5-9-19(21)17-10-12-18(20)13-11-17/h2-4,7-8,10-13,15,19H,5-6,9,14H2,1H3/t15-,19+/m1/s1 |
| InChIKey | ASPNOHZIVGOUPC-BEFAXECRSA-N |
| XLogP | 5.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |