C23H24F6N2O3 — CID 118395867
N-[4-[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]-2-oxoethyl]phenyl]-N,2,2-trimethylpropanamide (PubChem CID 118395867) has the molecular formula C23H24F6N2O3 and a molecular weight of 490.44 g/mol. Its IUPAC name is N-[4-[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]-2-oxoethyl]phenyl]-N,2,2-trimethylpropanamide.
| Compound Name | N-[4-[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]-2-oxoethyl]phenyl]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 118395867 |
| Molecular Formula | C23H24F6N2O3 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-[4-[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)anilino]-2-oxoethyl]phenyl]-N,2,2-trimethylpropanamide |
| SMILES | CN(C(=O)C(C)(C)C)c1ccc(CC(=O)Nc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H24F6N2O3/c1-20(2,3)19(33)31(4)17-11-5-14(6-12-17)13-18(32)30-16-9-7-15(8-10-16)21(34,22(24,25)26)23(27,28)29/h5-12,34H,13H2,1-4H3,(H,30,32) |
| InChIKey | DEJJQCBWZDJQOM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |