About cyclohexyl-[5-(2,6-dimethoxyphenyl)-1-naphthalen-1-ylpyrazol-3-yl]methanone
cyclohexyl-[5-(2,6-dimethoxyphenyl)-1-naphthalen-1-ylpyrazol-3-yl]methanone (PubChem CID 118395875) has the molecular formula C28H28N2O3
and a molecular weight of 440.54 g/mol. Its IUPAC name is cyclohexyl-[5-(2,6-dimethoxyphenyl)-1-naphthalen-1-ylpyrazol-3-yl]methanone.
Molecular Properties
| Compound Name | cyclohexyl-[5-(2,6-dimethoxyphenyl)-1-naphthalen-1-ylpyrazol-3-yl]methanone |
| PubChem CID | 118395875 |
| Molecular Formula | C28H28N2O3 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | cyclohexyl-[5-(2,6-dimethoxyphenyl)-1-naphthalen-1-ylpyrazol-3-yl]methanone |
| SMILES | COc1cccc(OC)c1-c1cc(C(=O)C2CCCCC2)nn1-c1cccc2ccccc12 |
| InChI | InChI=1S/C28H28N2O3/c1-32-25-16-9-17-26(33-2)27(25)24-18-22(28(31)20-11-4-3-5-12-20)29-30(24)23-15-8-13-19-10-6-7-14-21(19)23/h6-10,13-18,20H,3-5,11-12H2,1-2H3 |
| InChIKey | SWEGTTRRHIKVDQ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexyl-[5-(2,6-dimethoxyphenyl)-1-naphthalen-1-ylpyrazol-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-[5-(2,6-dimethoxyphenyl)-1-naphthalen-1-ylpyrazol-3-yl]methanone?
The IUPAC name of cyclohexyl-[5-(2,6-dimethoxyphenyl)-1-naphthalen-1-ylpyrazol-3-yl]methanone (CID 118395875) is cyclohexyl-[5-(2,6-dimethoxyphenyl)-1-naphthalen-1-ylpyrazol-3-yl]methanone.
What is the SMILES notation for cyclohexyl-[5-(2,6-dimethoxyphenyl)-1-naphthalen-1-ylpyrazol-3-yl]methanone?
The canonical SMILES for cyclohexyl-[5-(2,6-dimethoxyphenyl)-1-naphthalen-1-ylpyrazol-3-yl]methanone is COc1cccc(OC)c1-c1cc(C(=O)C2CCCCC2)nn1-c1cccc2ccccc12.
What is the InChIKey of cyclohexyl-[5-(2,6-dimethoxyphenyl)-1-naphthalen-1-ylpyrazol-3-yl]methanone?
The InChIKey is SWEGTTRRHIKVDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28N2O3/c1-32-25-16-9-17-26(33-2)27(25)24-18-22(28(31)20-11-4-3-5-12-20)29-30(24)23-15-8-13-19-10-6-7-14-21(19)23/h6-10,13-18,20H,3-5,11-12H2,1-2H3.
What are the key properties of cyclohexyl-[5-(2,6-dimethoxyphenyl)-1-naphthalen-1-ylpyrazol-3-yl]methanone?
cyclohexyl-[5-(2,6-dimethoxyphenyl)-1-naphthalen-1-ylpyrazol-3-yl]methanone has a molecular weight of 440.54 g/mol, XLogP of 6.47, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-[5-(2,6-dimethoxyphenyl)-1-naphthalen-1-ylpyrazol-3-yl]methanone is sourced from PubChem (CID 118395875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).