C19H17F6NO3S — CID 118395947
2-(4-ethylsulfonylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]acetamide (PubChem CID 118395947) has the molecular formula C19H17F6NO3S and a molecular weight of 453.40 g/mol. Its IUPAC name is 2-(4-ethylsulfonylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]acetamide.
| Compound Name | 2-(4-ethylsulfonylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 118395947 |
| Molecular Formula | C19H17F6NO3S |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 453.08 |
| IUPAC Name | 2-(4-ethylsulfonylphenyl)-N-[4-(1,1,1,3,3,3-hexafluoropropan-2-yl)phenyl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2ccc(C(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H17F6NO3S/c1-2-30(28,29)15-9-3-12(4-10-15)11-16(27)26-14-7-5-13(6-8-14)17(18(20,21)22)19(23,24)25/h3-10,17H,2,11H2,1H3,(H,26,27) |
| InChIKey | RCLTXVLRVSWDOB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |