About 5-methyl-2,4-bis(trifluoromethyl)cyclohexa-2,4-dien-1-ol
5-methyl-2,4-bis(trifluoromethyl)cyclohexa-2,4-dien-1-ol (PubChem CID 118396525) has the molecular formula C9H8F6O
and a molecular weight of 246.15 g/mol. Its IUPAC name is 5-methyl-2,4-bis(trifluoromethyl)cyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | 5-methyl-2,4-bis(trifluoromethyl)cyclohexa-2,4-dien-1-ol |
| PubChem CID | 118396525 |
| Molecular Formula | C9H8F6O |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 5-methyl-2,4-bis(trifluoromethyl)cyclohexa-2,4-dien-1-ol |
| SMILES | CC1=C(C(F)(F)F)C=C(C(F)(F)F)C(O)C1 |
| InChI | InChI=1S/C9H8F6O/c1-4-2-7(16)6(9(13,14)15)3-5(4)8(10,11)12/h3,7,16H,2H2,1H3 |
| InChIKey | FEVNUINHMFSFMZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methyl-2,4-bis(trifluoromethyl)cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,4-bis(trifluoromethyl)cyclohexa-2,4-dien-1-ol?
The IUPAC name of 5-methyl-2,4-bis(trifluoromethyl)cyclohexa-2,4-dien-1-ol (CID 118396525) is 5-methyl-2,4-bis(trifluoromethyl)cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for 5-methyl-2,4-bis(trifluoromethyl)cyclohexa-2,4-dien-1-ol?
The canonical SMILES for 5-methyl-2,4-bis(trifluoromethyl)cyclohexa-2,4-dien-1-ol is CC1=C(C(F)(F)F)C=C(C(F)(F)F)C(O)C1.
What is the InChIKey of 5-methyl-2,4-bis(trifluoromethyl)cyclohexa-2,4-dien-1-ol?
The InChIKey is FEVNUINHMFSFMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8F6O/c1-4-2-7(16)6(9(13,14)15)3-5(4)8(10,11)12/h3,7,16H,2H2,1H3.
What are the key properties of 5-methyl-2,4-bis(trifluoromethyl)cyclohexa-2,4-dien-1-ol?
5-methyl-2,4-bis(trifluoromethyl)cyclohexa-2,4-dien-1-ol has a molecular weight of 246.15 g/mol, XLogP of 3.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,4-bis(trifluoromethyl)cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 118396525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).