C16H13BrF4N4O — CID 118397056
N'-[(2R)-3-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]-N-(methylideneamino)methanimidamide (PubChem CID 118397056) has the molecular formula C16H13BrF4N4O and a molecular weight of 433.20 g/mol. Its IUPAC name is N'-[(2R)-3-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]-N-(methylideneamino)methanimidamide.
| Compound Name | N'-[(2R)-3-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]-N-(methylideneamino)methanimidamide |
|---|---|
| PubChem CID | 118397056 |
| Molecular Formula | C16H13BrF4N4O |
| Molecular Weight | 433.20 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | N'-[(2R)-3-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxypropyl]-N-(methylideneamino)methanimidamide |
| SMILES | C=NN/C=N/C[C@](O)(c1ccc(F)cc1F)C(F)(F)c1ccc(Br)cn1 |
| InChI | InChI=1S/C16H13BrF4N4O/c1-22-25-9-23-8-15(26,12-4-3-11(18)6-13(12)19)16(20,21)14-5-2-10(17)7-24-14/h2-7,9,26H,1,8H2,(H,23,25)/t15-/m0/s1 |
| InChIKey | ADKGPOSFAYLXET-HNNXBMFYSA-N |
| XLogP | 3.34 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.20 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|