C30H34N4OS — CID 11839779
3-benzylsulfanyl-6-(3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 11839779) has the molecular formula C30H34N4OS and a molecular weight of 498.70 g/mol. Its IUPAC name is 3-benzylsulfanyl-6-(3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 3-benzylsulfanyl-6-(3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 11839779 |
| Molecular Formula | C30H34N4OS |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 3-benzylsulfanyl-6-(3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl)-6,7-dihydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CC1CC2=CCCC(C)(C)C2CC1C1Nc2ccccc2-c2nnc(SCc3ccccc3)nc2O1 |
| InChI | InChI=1S/C30H34N4OS/c1-19-16-21-12-9-15-30(2,3)24(21)17-23(19)27-31-25-14-8-7-13-22(25)26-28(35-27)32-29(34-33-26)36-18-20-10-5-4-6-11-20/h4-8,10-14,19,23-24,27,31H,9,15-18H2,1-3H3 |
| InChIKey | MGRDNSMSSKCMOK-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|