C29H17N3S — CID 118397898
5-[6-(7-phenyldibenzothiophen-3-yl)-2-pyridinyl]pyridine-3-carbonitrile (PubChem CID 118397898) has the molecular formula C29H17N3S and a molecular weight of 439.54 g/mol. Its IUPAC name is 5-[6-(7-phenyldibenzothiophen-3-yl)-2-pyridinyl]pyridine-3-carbonitrile.
| Compound Name | 5-[6-(7-phenyldibenzothiophen-3-yl)-2-pyridinyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 118397898 |
| Molecular Formula | C29H17N3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 5-[6-(7-phenyldibenzothiophen-3-yl)-2-pyridinyl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(-c2cccc(-c3ccc4c(c3)sc3cc(-c5ccccc5)ccc34)n2)c1 |
| InChI | InChI=1S/C29H17N3S/c30-16-19-13-23(18-31-17-19)27-8-4-7-26(32-27)22-10-12-25-24-11-9-21(20-5-2-1-3-6-20)14-28(24)33-29(25)15-22/h1-15,17-18H |
| InChIKey | WJEJIXXGPRUGJF-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |