C37H31FN4O5 — CID 118398850
8-(2-anilino-2-oxoacetyl)-5-[3-(tert-butylcarbamoyl)phenyl]-2-(4-fluorophenyl)-N-methyl-6H-furo[2,3-e]indole-3-carboxamide (PubChem CID 118398850) has the molecular formula C37H31FN4O5 and a molecular weight of 630.68 g/mol. Its IUPAC name is 8-(2-anilino-2-oxoacetyl)-5-[3-(tert-butylcarbamoyl)phenyl]-2-(4-fluorophenyl)-N-methyl-6H-furo[2,3-e]indole-3-carboxamide.
| Compound Name | 8-(2-anilino-2-oxoacetyl)-5-[3-(tert-butylcarbamoyl)phenyl]-2-(4-fluorophenyl)-N-methyl-6H-furo[2,3-e]indole-3-carboxamide |
|---|---|
| PubChem CID | 118398850 |
| Molecular Formula | C37H31FN4O5 |
| Molecular Weight | 630.68 g/mol |
| Exact Mass | 630.23 |
| IUPAC Name | 8-(2-anilino-2-oxoacetyl)-5-[3-(tert-butylcarbamoyl)phenyl]-2-(4-fluorophenyl)-N-methyl-6H-furo[2,3-e]indole-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2c1cc(-c1cccc(C(=O)NC(C)(C)C)c1)c1[nH]cc(C(=O)C(=O)Nc3ccccc3)c12 |
| InChI | InChI=1S/C37H31FN4O5/c1-37(2,3)42-34(44)22-10-8-9-21(17-22)25-18-26-29(35(45)39-4)32(20-13-15-23(38)16-14-20)47-33(26)28-27(19-40-30(25)28)31(43)36(46)41-24-11-6-5-7-12-24/h5-19,40H,1-4H3,(H,39,45)(H,41,46)(H,42,44) |
| InChIKey | XUMCCCCLLAANGZ-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 133.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.68 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|