C27H28ClF2N5O2 — CID 118400021
3-(3-chloro-2,6-difluorophenyl)-7-[[5-[2-(diethylamino)ethoxy]-2-pyridinyl]amino]-1-ethyl-1,6-naphthyridin-2-one (PubChem CID 118400021) has the molecular formula C27H28ClF2N5O2 and a molecular weight of 528.00 g/mol. Its IUPAC name is 3-(3-chloro-2,6-difluorophenyl)-7-[[5-[2-(diethylamino)ethoxy]-2-pyridinyl]amino]-1-ethyl-1,6-naphthyridin-2-one.
| Compound Name | 3-(3-chloro-2,6-difluorophenyl)-7-[[5-[2-(diethylamino)ethoxy]-2-pyridinyl]amino]-1-ethyl-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 118400021 |
| Molecular Formula | C27H28ClF2N5O2 |
| Molecular Weight | 528.00 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | 3-(3-chloro-2,6-difluorophenyl)-7-[[5-[2-(diethylamino)ethoxy]-2-pyridinyl]amino]-1-ethyl-1,6-naphthyridin-2-one |
| SMILES | CCN(CC)CCOc1ccc(Nc2cc3c(cn2)cc(-c2c(F)ccc(Cl)c2F)c(=O)n3CC)nc1 |
| InChI | InChI=1S/C27H28ClF2N5O2/c1-4-34(5-2)11-12-37-18-7-10-23(32-16-18)33-24-14-22-17(15-31-24)13-19(27(36)35(22)6-3)25-21(29)9-8-20(28)26(25)30/h7-10,13-16H,4-6,11-12H2,1-3H3,(H,31,32,33) |
| InChIKey | NYODZZBZDWAACH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.00 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|