C23H20N2O5 — CID 11840061
2-amino-3-(4-methylbenzoyl)-4-(4-nitrophenyl)-4,6,7,8-tetrahydrochromen-5-one (PubChem CID 11840061) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-amino-3-(4-methylbenzoyl)-4-(4-nitrophenyl)-4,6,7,8-tetrahydrochromen-5-one.
| Compound Name | 2-amino-3-(4-methylbenzoyl)-4-(4-nitrophenyl)-4,6,7,8-tetrahydrochromen-5-one |
|---|---|
| PubChem CID | 11840061 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-amino-3-(4-methylbenzoyl)-4-(4-nitrophenyl)-4,6,7,8-tetrahydrochromen-5-one |
| SMILES | Cc1ccc(C(=O)C2=C(N)OC3=C(C(=O)CCC3)C2c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C23H20N2O5/c1-13-5-7-15(8-6-13)22(27)21-19(14-9-11-16(12-10-14)25(28)29)20-17(26)3-2-4-18(20)30-23(21)24/h5-12,19H,2-4,24H2,1H3 |
| InChIKey | HOLJUVPQAJBKMU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|