C13H16F6O2S — CID 118400659
(2Z,4E)-1,1,1-trifluoro-5,9-dimethyl-2-(trifluoromethylsulfonyl)deca-2,4,8-triene (PubChem CID 118400659) has the molecular formula C13H16F6O2S and a molecular weight of 350.32 g/mol. Its IUPAC name is (2Z,4E)-1,1,1-trifluoro-5,9-dimethyl-2-(trifluoromethylsulfonyl)deca-2,4,8-triene.
| Compound Name | (2Z,4E)-1,1,1-trifluoro-5,9-dimethyl-2-(trifluoromethylsulfonyl)deca-2,4,8-triene |
|---|---|
| PubChem CID | 118400659 |
| Molecular Formula | C13H16F6O2S |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | (2Z,4E)-1,1,1-trifluoro-5,9-dimethyl-2-(trifluoromethylsulfonyl)deca-2,4,8-triene |
| SMILES | CC(C)=CCC/C(C)=C/C=C(/C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H16F6O2S/c1-9(2)5-4-6-10(3)7-8-11(12(14,15)16)22(20,21)13(17,18)19/h5,7-8H,4,6H2,1-3H3/b10-7+,11-8- |
| InChIKey | XYUAJONCFPNKEE-WAKDDQPJSA-N |
| XLogP | 5.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|