About 5-[3,3,3-trifluoro-2-(trifluoromethylsulfonyl)propyl]bicyclo[2.2.1]hept-2-ene
5-[3,3,3-trifluoro-2-(trifluoromethylsulfonyl)propyl]bicyclo[2.2.1]hept-2-ene (PubChem CID 118400683) has the molecular formula C11H12F6O2S
and a molecular weight of 322.27 g/mol. Its IUPAC name is 5-[3,3,3-trifluoro-2-(trifluoromethylsulfonyl)propyl]bicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | 5-[3,3,3-trifluoro-2-(trifluoromethylsulfonyl)propyl]bicyclo[2.2.1]hept-2-ene |
| PubChem CID | 118400683 |
| Molecular Formula | C11H12F6O2S |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 5-[3,3,3-trifluoro-2-(trifluoromethylsulfonyl)propyl]bicyclo[2.2.1]hept-2-ene |
| SMILES | O=S(=O)(C(CC1CC2C=CC1C2)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F6O2S/c12-10(13,14)9(20(18,19)11(15,16)17)5-8-4-6-1-2-7(8)3-6/h1-2,6-9H,3-5H2 |
| InChIKey | VFLSZRRMTWPPPY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[3,3,3-trifluoro-2-(trifluoromethylsulfonyl)propyl]bicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,3,3-trifluoro-2-(trifluoromethylsulfonyl)propyl]bicyclo[2.2.1]hept-2-ene?
The IUPAC name of 5-[3,3,3-trifluoro-2-(trifluoromethylsulfonyl)propyl]bicyclo[2.2.1]hept-2-ene (CID 118400683) is 5-[3,3,3-trifluoro-2-(trifluoromethylsulfonyl)propyl]bicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for 5-[3,3,3-trifluoro-2-(trifluoromethylsulfonyl)propyl]bicyclo[2.2.1]hept-2-ene?
The canonical SMILES for 5-[3,3,3-trifluoro-2-(trifluoromethylsulfonyl)propyl]bicyclo[2.2.1]hept-2-ene is O=S(=O)(C(CC1CC2C=CC1C2)C(F)(F)F)C(F)(F)F.
What is the InChIKey of 5-[3,3,3-trifluoro-2-(trifluoromethylsulfonyl)propyl]bicyclo[2.2.1]hept-2-ene?
The InChIKey is VFLSZRRMTWPPPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F6O2S/c12-10(13,14)9(20(18,19)11(15,16)17)5-8-4-6-1-2-7(8)3-6/h1-2,6-9H,3-5H2.
What are the key properties of 5-[3,3,3-trifluoro-2-(trifluoromethylsulfonyl)propyl]bicyclo[2.2.1]hept-2-ene?
5-[3,3,3-trifluoro-2-(trifluoromethylsulfonyl)propyl]bicyclo[2.2.1]hept-2-ene has a molecular weight of 322.27 g/mol, XLogP of 3.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,3,3-trifluoro-2-(trifluoromethylsulfonyl)propyl]bicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 118400683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).