C12H22O4 — CID 118400698
(2Z)-2,3-diethyl-1,4,7,10-tetraoxacyclododec-2-ene (PubChem CID 118400698) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is (2Z)-2,3-diethyl-1,4,7,10-tetraoxacyclododec-2-ene.
| Compound Name | (2Z)-2,3-diethyl-1,4,7,10-tetraoxacyclododec-2-ene |
|---|---|
| PubChem CID | 118400698 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | (2Z)-2,3-diethyl-1,4,7,10-tetraoxacyclododec-2-ene |
| SMILES | CC/C1=C(\CC)OCCOCCOCCO1 |
| InChI | InChI=1S/C12H22O4/c1-3-11-12(4-2)16-10-8-14-6-5-13-7-9-15-11/h3-10H2,1-2H3/b12-11- |
| InChIKey | CCQPCUJKUQSVCS-QXMHVHEDSA-N |
| XLogP | 2.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |