C27H33N3O6 — CID 118400854
(E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)-N-[[(3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]but-2-enamide (PubChem CID 118400854) has the molecular formula C27H33N3O6 and a molecular weight of 495.58 g/mol. Its IUPAC name is (E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)-N-[[(3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]but-2-enamide.
| Compound Name | (E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)-N-[[(3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 118400854 |
| Molecular Formula | C27H33N3O6 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | (E)-2-cyano-3-(6-piperidin-1-ylnaphthalen-2-yl)-N-[[(3S,4S,5R,6S)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]but-2-enamide |
| SMILES | CO[C@H]1OC(CNC(=O)/C(C#N)=C(\C)c2ccc3cc(N4CCCCC4)ccc3c2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H33N3O6/c1-16(17-6-7-19-13-20(9-8-18(19)12-17)30-10-4-3-5-11-30)21(14-28)26(34)29-15-22-23(31)24(32)25(33)27(35-2)36-22/h6-9,12-13,22-25,27,31-33H,3-5,10-11,15H2,1-2H3,(H,29,34)/b21-16+/t22?,23-,24+,25-,27+/m1/s1 |
| InChIKey | XZZDZMSDQMNHHB-PNENOQLUSA-N |
| XLogP | 1.70 |
| TPSA | 135.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|