C30H36N4O8S2 — CID 118401102
(E)-1-cyano-2-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-1-ene-1-sulfonamide (PubChem CID 118401102) has the molecular formula C30H36N4O8S2 and a molecular weight of 644.77 g/mol. Its IUPAC name is (E)-1-cyano-2-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-1-ene-1-sulfonamide.
| Compound Name | (E)-1-cyano-2-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 118401102 |
| Molecular Formula | C30H36N4O8S2 |
| Molecular Weight | 644.77 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | (E)-1-cyano-2-[5-[6-(2-morpholin-4-ylethylamino)naphthalen-2-yl]thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-1-ene-1-sulfonamide |
| SMILES | C/C(=C(/C#N)S(=O)(=O)NC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O)c1ccc(-c2ccc3cc(NCCN4CCOCC4)ccc3c2)s1 |
| InChI | InChI=1S/C30H36N4O8S2/c1-18(26(16-31)44(39,40)33-17-23-27(35)28(36)29(37)30(38)42-23)24-6-7-25(43-24)21-3-2-20-15-22(5-4-19(20)14-21)32-8-9-34-10-12-41-13-11-34/h2-7,14-15,23,27-30,32-33,35-38H,8-13,17H2,1H3/b26-18+/t23-,27-,28+,29-,30?/m1/s1 |
| InChIKey | FCJZSVXEPBHQLG-RVRVWIOMSA-N |
| XLogP | 1.29 |
| TPSA | 184.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.77 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|