C28H31N3O8S2 — CID 118401183
(E)-1-cyano-2-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-1-ene-1-sulfonamide (PubChem CID 118401183) has the molecular formula C28H31N3O8S2 and a molecular weight of 601.70 g/mol. Its IUPAC name is (E)-1-cyano-2-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-1-ene-1-sulfonamide.
| Compound Name | (E)-1-cyano-2-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-1-ene-1-sulfonamide |
|---|---|
| PubChem CID | 118401183 |
| Molecular Formula | C28H31N3O8S2 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.16 |
| IUPAC Name | (E)-1-cyano-2-[5-(6-morpholin-4-ylnaphthalen-2-yl)thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]prop-1-ene-1-sulfonamide |
| SMILES | C/C(=C(/C#N)S(=O)(=O)NC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O)c1ccc(-c2ccc3cc(N4CCOCC4)ccc3c2)s1 |
| InChI | InChI=1S/C28H31N3O8S2/c1-16(24(14-29)41(36,37)30-15-21-25(32)26(33)27(34)28(35)39-21)22-6-7-23(40-22)19-3-2-18-13-20(5-4-17(18)12-19)31-8-10-38-11-9-31/h2-7,12-13,21,25-28,30,32-35H,8-11,15H2,1H3/b24-16+/t21-,25-,26+,27-,28?/m1/s1 |
| InChIKey | AXRJVZZSPSWBSK-ZLUFOQFLSA-N |
| XLogP | 1.38 |
| TPSA | 172.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|