C30H33N3O6S — CID 118401187
(E)-2-cyano-3-[5-(6-piperidin-1-ylnaphthalen-2-yl)thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]but-2-enamide (PubChem CID 118401187) has the molecular formula C30H33N3O6S and a molecular weight of 563.68 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-(6-piperidin-1-ylnaphthalen-2-yl)thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]but-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-(6-piperidin-1-ylnaphthalen-2-yl)thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]but-2-enamide |
|---|---|
| PubChem CID | 118401187 |
| Molecular Formula | C30H33N3O6S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | (E)-2-cyano-3-[5-(6-piperidin-1-ylnaphthalen-2-yl)thiophen-2-yl]-N-[[(2R,3S,4S,5R)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]but-2-enamide |
| SMILES | C/C(=C(/C#N)C(=O)NC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O)c1ccc(-c2ccc3cc(N4CCCCC4)ccc3c2)s1 |
| InChI | InChI=1S/C30H33N3O6S/c1-17(22(15-31)29(37)32-16-23-26(34)27(35)28(36)30(38)39-23)24-9-10-25(40-24)20-6-5-19-14-21(8-7-18(19)13-20)33-11-3-2-4-12-33/h5-10,13-14,23,26-28,30,34-36,38H,2-4,11-12,16H2,1H3,(H,32,37)/b22-17+/t23-,26-,27+,28-,30?/m1/s1 |
| InChIKey | OCQCAVVKRUIVMK-ABFAGIPNSA-N |
| XLogP | 2.77 |
| TPSA | 146.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|